C16H22N4O — CID 66212034
2-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-5,6,7,8-tetrahydroquinoline-3-carboxamide (PubChem CID 66212034) has the molecular formula C16H22N4O and a molecular weight of 286.38 g/mol. Its IUPAC name is 2-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-5,6,7,8-tetrahydroquinoline-3-carboxamide.
| Compound Name | 2-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-5,6,7,8-tetrahydroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 66212034 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 2-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-5,6,7,8-tetrahydroquinoline-3-carboxamide |
| SMILES | NC(=O)c1cc2c(nc1N1CC3CNCC3C1)CCCC2 |
| InChI | InChI=1S/C16H22N4O/c17-15(21)13-5-10-3-1-2-4-14(10)19-16(13)20-8-11-6-18-7-12(11)9-20/h5,11-12,18H,1-4,6-9H2,(H2,17,21) |
| InChIKey | PLBYTHJPVUNHLG-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |