C14H17FN2O2 — CID 66212567
2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl-(3-fluoro-4-methoxyphenyl)methanone (PubChem CID 66212567) has the molecular formula C14H17FN2O2 and a molecular weight of 264.30 g/mol. Its IUPAC name is 2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl-(3-fluoro-4-methoxyphenyl)methanone.
| Compound Name | 2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl-(3-fluoro-4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 66212567 |
| Molecular Formula | C14H17FN2O2 |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl-(3-fluoro-4-methoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)N2CC3CNCC3C2)cc1F |
| InChI | InChI=1S/C14H17FN2O2/c1-19-13-3-2-9(4-12(13)15)14(18)17-7-10-5-16-6-11(10)8-17/h2-4,10-11,16H,5-8H2,1H3 |
| InChIKey | XAWYZKASAUHCIL-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |