C16H20N2O3 — CID 66212729
4-(7-amino-2-oxabicyclo[4.2.0]octan-8-yl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 66212729) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 4-(7-amino-2-oxabicyclo[4.2.0]octan-8-yl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | 4-(7-amino-2-oxabicyclo[4.2.0]octan-8-yl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 66212729 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 4-(7-amino-2-oxabicyclo[4.2.0]octan-8-yl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | NC1C2CCCOC2C1N1C(=O)C2C3C=CC(C3)C2C1=O |
| InChI | InChI=1S/C16H20N2O3/c17-12-9-2-1-5-21-14(9)13(12)18-15(19)10-7-3-4-8(6-7)11(10)16(18)20/h3-4,7-14H,1-2,5-6,17H2 |
| InChIKey | IHTXJRIKVNHFNP-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|