C13H19N3O2S — CID 66213179
5-(2-pyridin-2-ylethylsulfonyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole (PubChem CID 66213179) has the molecular formula C13H19N3O2S and a molecular weight of 281.38 g/mol. Its IUPAC name is 5-(2-pyridin-2-ylethylsulfonyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole.
| Compound Name | 5-(2-pyridin-2-ylethylsulfonyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 66213179 |
| Molecular Formula | C13H19N3O2S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 5-(2-pyridin-2-ylethylsulfonyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
| SMILES | O=S(=O)(CCc1ccccn1)N1CC2CNCC2C1 |
| InChI | InChI=1S/C13H19N3O2S/c17-19(18,6-4-13-3-1-2-5-15-13)16-9-11-7-14-8-12(11)10-16/h1-3,5,11-12,14H,4,6-10H2 |
| InChIKey | LYTMWUMAONZZOY-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |