C17H26N2 — CID 66213220
5-[1-(2,4-dimethylphenyl)ethyl]-4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole (PubChem CID 66213220) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is 5-[1-(2,4-dimethylphenyl)ethyl]-4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole.
| Compound Name | 5-[1-(2,4-dimethylphenyl)ethyl]-4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 66213220 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 5-[1-(2,4-dimethylphenyl)ethyl]-4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
| SMILES | Cc1ccc(C(C)N2CC3CNCC3C2C)c(C)c1 |
| InChI | InChI=1S/C17H26N2/c1-11-5-6-16(12(2)7-11)13(3)19-10-15-8-18-9-17(15)14(19)4/h5-7,13-15,17-18H,8-10H2,1-4H3 |
| InChIKey | FLCVYXRNXHTYPX-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |