About 1-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)triazole-4-carbaldehyde
1-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)triazole-4-carbaldehyde (PubChem CID 66213817) has the molecular formula C9H3Cl2N5OS
and a molecular weight of 300.13 g/mol. Its IUPAC name is 1-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)triazole-4-carbaldehyde.
Molecular Properties
| Compound Name | 1-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)triazole-4-carbaldehyde |
| PubChem CID | 66213817 |
| Molecular Formula | C9H3Cl2N5OS |
| Molecular Weight | 300.13 g/mol |
| Exact Mass | 298.94 |
| IUPAC Name | 1-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)triazole-4-carbaldehyde |
| SMILES | O=Cc1cn(-c2c(Cl)cc(Cl)c3nsnc23)nn1 |
| InChI | InChI=1S/C9H3Cl2N5OS/c10-5-1-6(11)9(8-7(5)13-18-14-8)16-2-4(3-17)12-15-16/h1-3H |
| InChIKey | ABNFAWSBIHYRJX-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 73.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.13 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)triazole-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)triazole-4-carbaldehyde?
The IUPAC name of 1-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)triazole-4-carbaldehyde (CID 66213817) is 1-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)triazole-4-carbaldehyde.
What is the SMILES notation for 1-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)triazole-4-carbaldehyde?
The canonical SMILES for 1-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)triazole-4-carbaldehyde is O=Cc1cn(-c2c(Cl)cc(Cl)c3nsnc23)nn1.
What is the InChIKey of 1-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)triazole-4-carbaldehyde?
The InChIKey is ABNFAWSBIHYRJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H3Cl2N5OS/c10-5-1-6(11)9(8-7(5)13-18-14-8)16-2-4(3-17)12-15-16/h1-3H.
What are the key properties of 1-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)triazole-4-carbaldehyde?
1-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)triazole-4-carbaldehyde has a molecular weight of 300.13 g/mol, XLogP of 2.39, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)triazole-4-carbaldehyde is sourced from PubChem (CID 66213817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).