C11H17F3N4O3 — CID 66213957
2-[4-(diethoxymethyl)triazol-1-yl]-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 66213957) has the molecular formula C11H17F3N4O3 and a molecular weight of 310.28 g/mol. Its IUPAC name is 2-[4-(diethoxymethyl)triazol-1-yl]-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[4-(diethoxymethyl)triazol-1-yl]-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 66213957 |
| Molecular Formula | C11H17F3N4O3 |
| Molecular Weight | 310.28 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 2-[4-(diethoxymethyl)triazol-1-yl]-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | CCOC(OCC)c1cn(CC(=O)NCC(F)(F)F)nn1 |
| InChI | InChI=1S/C11H17F3N4O3/c1-3-20-10(21-4-2)8-5-18(17-16-8)6-9(19)15-7-11(12,13)14/h5,10H,3-4,6-7H2,1-2H3,(H,15,19) |
| InChIKey | GSDLCIZMUYNWSZ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.28 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|