About 1-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl]triazole-4-carbaldehyde
1-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl]triazole-4-carbaldehyde (PubChem CID 66214390) has the molecular formula C12H8BrN5O2
and a molecular weight of 334.13 g/mol. Its IUPAC name is 1-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl]triazole-4-carbaldehyde.
Molecular Properties
| Compound Name | 1-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl]triazole-4-carbaldehyde |
| PubChem CID | 66214390 |
| Molecular Formula | C12H8BrN5O2 |
| Molecular Weight | 334.13 g/mol |
| Exact Mass | 332.99 |
| IUPAC Name | 1-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl]triazole-4-carbaldehyde |
| SMILES | O=Cc1cn(Cc2nnc(-c3ccccc3Br)o2)nn1 |
| InChI | InChI=1S/C12H8BrN5O2/c13-10-4-2-1-3-9(10)12-16-15-11(20-12)6-18-5-8(7-19)14-17-18/h1-5,7H,6H2 |
| InChIKey | IKZGZSVFXWPION-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 86.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.13 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl]triazole-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl]triazole-4-carbaldehyde?
The IUPAC name of 1-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl]triazole-4-carbaldehyde (CID 66214390) is 1-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl]triazole-4-carbaldehyde.
What is the SMILES notation for 1-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl]triazole-4-carbaldehyde?
The canonical SMILES for 1-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl]triazole-4-carbaldehyde is O=Cc1cn(Cc2nnc(-c3ccccc3Br)o2)nn1.
What is the InChIKey of 1-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl]triazole-4-carbaldehyde?
The InChIKey is IKZGZSVFXWPION-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8BrN5O2/c13-10-4-2-1-3-9(10)12-16-15-11(20-12)6-18-5-8(7-19)14-17-18/h1-5,7H,6H2.
What are the key properties of 1-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl]triazole-4-carbaldehyde?
1-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl]triazole-4-carbaldehyde has a molecular weight of 334.13 g/mol, XLogP of 1.95, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl]triazole-4-carbaldehyde is sourced from PubChem (CID 66214390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).