About 7-methoxy-N-methyl-N-phenyl-4,5-dihydrobenzo[g][1,2]benzoxazole-3-carboxamide
7-methoxy-N-methyl-N-phenyl-4,5-dihydrobenzo[g][1,2]benzoxazole-3-carboxamide (PubChem CID 6621443) has the molecular formula C20H18N2O3
and a molecular weight of 334.38 g/mol. Its IUPAC name is 7-methoxy-N-methyl-N-phenyl-4,5-dihydrobenzo[g][1,2]benzoxazole-3-carboxamide.
Molecular Properties
| Compound Name | 7-methoxy-N-methyl-N-phenyl-4,5-dihydrobenzo[g][1,2]benzoxazole-3-carboxamide |
| PubChem CID | 6621443 |
| Molecular Formula | C20H18N2O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 7-methoxy-N-methyl-N-phenyl-4,5-dihydrobenzo[g][1,2]benzoxazole-3-carboxamide |
| SMILES | COc1ccc2c(c1)CCc1c(C(=O)N(C)c3ccccc3)noc1-2 |
| InChI | InChI=1S/C20H18N2O3/c1-22(14-6-4-3-5-7-14)20(23)18-17-10-8-13-12-15(24-2)9-11-16(13)19(17)25-21-18/h3-7,9,11-12H,8,10H2,1-2H3 |
| InChIKey | FORYESFIEOBZHJ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-methoxy-N-methyl-N-phenyl-4,5-dihydrobenzo[g][1,2]benzoxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-N-methyl-N-phenyl-4,5-dihydrobenzo[g][1,2]benzoxazole-3-carboxamide?
The IUPAC name of 7-methoxy-N-methyl-N-phenyl-4,5-dihydrobenzo[g][1,2]benzoxazole-3-carboxamide (CID 6621443) is 7-methoxy-N-methyl-N-phenyl-4,5-dihydrobenzo[g][1,2]benzoxazole-3-carboxamide.
What is the SMILES notation for 7-methoxy-N-methyl-N-phenyl-4,5-dihydrobenzo[g][1,2]benzoxazole-3-carboxamide?
The canonical SMILES for 7-methoxy-N-methyl-N-phenyl-4,5-dihydrobenzo[g][1,2]benzoxazole-3-carboxamide is COc1ccc2c(c1)CCc1c(C(=O)N(C)c3ccccc3)noc1-2.
What is the InChIKey of 7-methoxy-N-methyl-N-phenyl-4,5-dihydrobenzo[g][1,2]benzoxazole-3-carboxamide?
The InChIKey is FORYESFIEOBZHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N2O3/c1-22(14-6-4-3-5-7-14)20(23)18-17-10-8-13-12-15(24-2)9-11-16(13)19(17)25-21-18/h3-7,9,11-12H,8,10H2,1-2H3.
What are the key properties of 7-methoxy-N-methyl-N-phenyl-4,5-dihydrobenzo[g][1,2]benzoxazole-3-carboxamide?
7-methoxy-N-methyl-N-phenyl-4,5-dihydrobenzo[g][1,2]benzoxazole-3-carboxamide has a molecular weight of 334.38 g/mol, XLogP of 3.73, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-N-methyl-N-phenyl-4,5-dihydrobenzo[g][1,2]benzoxazole-3-carboxamide is sourced from PubChem (CID 6621443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).