C8H14N4S — CID 66214743
N-(azetidin-3-yl)-N-propyl-1,2,4-thiadiazol-5-amine (PubChem CID 66214743) has the molecular formula C8H14N4S and a molecular weight of 198.29 g/mol. Its IUPAC name is N-(azetidin-3-yl)-N-propyl-1,2,4-thiadiazol-5-amine.
| Compound Name | N-(azetidin-3-yl)-N-propyl-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 66214743 |
| Molecular Formula | C8H14N4S |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | N-(azetidin-3-yl)-N-propyl-1,2,4-thiadiazol-5-amine |
| SMILES | CCCN(c1ncns1)C1CNC1 |
| InChI | InChI=1S/C8H14N4S/c1-2-3-12(7-4-9-5-7)8-10-6-11-13-8/h6-7,9H,2-5H2,1H3 |
| InChIKey | SCAIWFFJJYBFOU-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |