About 4-(diethoxymethyl)-1-(2,4,6-tribromophenyl)triazole
4-(diethoxymethyl)-1-(2,4,6-tribromophenyl)triazole (PubChem CID 66214816) has the molecular formula C13H14Br3N3O2
and a molecular weight of 483.99 g/mol. Its IUPAC name is 4-(diethoxymethyl)-1-(2,4,6-tribromophenyl)triazole.
Molecular Properties
| Compound Name | 4-(diethoxymethyl)-1-(2,4,6-tribromophenyl)triazole |
| PubChem CID | 66214816 |
| Molecular Formula | C13H14Br3N3O2 |
| Molecular Weight | 483.99 g/mol |
| Exact Mass | 480.86 |
| IUPAC Name | 4-(diethoxymethyl)-1-(2,4,6-tribromophenyl)triazole |
| SMILES | CCOC(OCC)c1cn(-c2c(Br)cc(Br)cc2Br)nn1 |
| InChI | InChI=1S/C13H14Br3N3O2/c1-3-20-13(21-4-2)11-7-19(18-17-11)12-9(15)5-8(14)6-10(12)16/h5-7,13H,3-4H2,1-2H3 |
| InChIKey | OHPASZSBTONBSN-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 483.99 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-(diethoxymethyl)-1-(2,4,6-tribromophenyl)triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(diethoxymethyl)-1-(2,4,6-tribromophenyl)triazole?
The IUPAC name of 4-(diethoxymethyl)-1-(2,4,6-tribromophenyl)triazole (CID 66214816) is 4-(diethoxymethyl)-1-(2,4,6-tribromophenyl)triazole.
What is the SMILES notation for 4-(diethoxymethyl)-1-(2,4,6-tribromophenyl)triazole?
The canonical SMILES for 4-(diethoxymethyl)-1-(2,4,6-tribromophenyl)triazole is CCOC(OCC)c1cn(-c2c(Br)cc(Br)cc2Br)nn1.
What is the InChIKey of 4-(diethoxymethyl)-1-(2,4,6-tribromophenyl)triazole?
The InChIKey is OHPASZSBTONBSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14Br3N3O2/c1-3-20-13(21-4-2)11-7-19(18-17-11)12-9(15)5-8(14)6-10(12)16/h5-7,13H,3-4H2,1-2H3.
What are the key properties of 4-(diethoxymethyl)-1-(2,4,6-tribromophenyl)triazole?
4-(diethoxymethyl)-1-(2,4,6-tribromophenyl)triazole has a molecular weight of 483.99 g/mol, XLogP of 4.63, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(diethoxymethyl)-1-(2,4,6-tribromophenyl)triazole is sourced from PubChem (CID 66214816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).