About N-(2,1,3-benzothiadiazol-4-ylcarbamothioyl)-3-methylbutanamide
N-(2,1,3-benzothiadiazol-4-ylcarbamothioyl)-3-methylbutanamide (PubChem CID 6621516) has the molecular formula C12H14N4OS2
and a molecular weight of 294.40 g/mol. Its IUPAC name is N-(2,1,3-benzothiadiazol-4-ylcarbamothioyl)-3-methylbutanamide.
Molecular Properties
| Compound Name | N-(2,1,3-benzothiadiazol-4-ylcarbamothioyl)-3-methylbutanamide |
| PubChem CID | 6621516 |
| Molecular Formula | C12H14N4OS2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | N-(2,1,3-benzothiadiazol-4-ylcarbamothioyl)-3-methylbutanamide |
| SMILES | CC(C)CC(=O)NC(=S)Nc1cccc2nsnc12 |
| InChI | InChI=1S/C12H14N4OS2/c1-7(2)6-10(17)14-12(18)13-8-4-3-5-9-11(8)16-19-15-9/h3-5,7H,6H2,1-2H3,(H2,13,14,17,18) |
| InChIKey | UOUUBWCGJLOSMH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-(2,1,3-benzothiadiazol-4-ylcarbamothioyl)-3-methylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,1,3-benzothiadiazol-4-ylcarbamothioyl)-3-methylbutanamide?
The IUPAC name of N-(2,1,3-benzothiadiazol-4-ylcarbamothioyl)-3-methylbutanamide (CID 6621516) is N-(2,1,3-benzothiadiazol-4-ylcarbamothioyl)-3-methylbutanamide.
What is the SMILES notation for N-(2,1,3-benzothiadiazol-4-ylcarbamothioyl)-3-methylbutanamide?
The canonical SMILES for N-(2,1,3-benzothiadiazol-4-ylcarbamothioyl)-3-methylbutanamide is CC(C)CC(=O)NC(=S)Nc1cccc2nsnc12.
What is the InChIKey of N-(2,1,3-benzothiadiazol-4-ylcarbamothioyl)-3-methylbutanamide?
The InChIKey is UOUUBWCGJLOSMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4OS2/c1-7(2)6-10(17)14-12(18)13-8-4-3-5-9-11(8)16-19-15-9/h3-5,7H,6H2,1-2H3,(H2,13,14,17,18).
What are the key properties of N-(2,1,3-benzothiadiazol-4-ylcarbamothioyl)-3-methylbutanamide?
N-(2,1,3-benzothiadiazol-4-ylcarbamothioyl)-3-methylbutanamide has a molecular weight of 294.40 g/mol, XLogP of 2.55, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,1,3-benzothiadiazol-4-ylcarbamothioyl)-3-methylbutanamide is sourced from PubChem (CID 6621516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).