About 4-(7-chloro-2,4-dioxo-1H-quinazolin-3-yl)-N-cyclooctylbutanamide
4-(7-chloro-2,4-dioxo-1H-quinazolin-3-yl)-N-cyclooctylbutanamide (PubChem CID 6621547) has the molecular formula C20H26ClN3O3
and a molecular weight of 391.90 g/mol. Its IUPAC name is 4-(7-chloro-2,4-dioxo-1H-quinazolin-3-yl)-N-cyclooctylbutanamide.
Molecular Properties
| Compound Name | 4-(7-chloro-2,4-dioxo-1H-quinazolin-3-yl)-N-cyclooctylbutanamide |
| PubChem CID | 6621547 |
| Molecular Formula | C20H26ClN3O3 |
| Molecular Weight | 391.90 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | 4-(7-chloro-2,4-dioxo-1H-quinazolin-3-yl)-N-cyclooctylbutanamide |
| SMILES | O=C(CCCn1c(=O)[nH]c2cc(Cl)ccc2c1=O)NC1CCCCCCC1 |
| InChI | InChI=1S/C20H26ClN3O3/c21-14-10-11-16-17(13-14)23-20(27)24(19(16)26)12-6-9-18(25)22-15-7-4-2-1-3-5-8-15/h10-11,13,15H,1-9,12H2,(H,22,25)(H,23,27) |
| InChIKey | IDQREQNSBRIEKV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.90 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(7-chloro-2,4-dioxo-1H-quinazolin-3-yl)-N-cyclooctylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(7-chloro-2,4-dioxo-1H-quinazolin-3-yl)-N-cyclooctylbutanamide?
The IUPAC name of 4-(7-chloro-2,4-dioxo-1H-quinazolin-3-yl)-N-cyclooctylbutanamide (CID 6621547) is 4-(7-chloro-2,4-dioxo-1H-quinazolin-3-yl)-N-cyclooctylbutanamide.
What is the SMILES notation for 4-(7-chloro-2,4-dioxo-1H-quinazolin-3-yl)-N-cyclooctylbutanamide?
The canonical SMILES for 4-(7-chloro-2,4-dioxo-1H-quinazolin-3-yl)-N-cyclooctylbutanamide is O=C(CCCn1c(=O)[nH]c2cc(Cl)ccc2c1=O)NC1CCCCCCC1.
What is the InChIKey of 4-(7-chloro-2,4-dioxo-1H-quinazolin-3-yl)-N-cyclooctylbutanamide?
The InChIKey is IDQREQNSBRIEKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26ClN3O3/c21-14-10-11-16-17(13-14)23-20(27)24(19(16)26)12-6-9-18(25)22-15-7-4-2-1-3-5-8-15/h10-11,13,15H,1-9,12H2,(H,22,25)(H,23,27).
What are the key properties of 4-(7-chloro-2,4-dioxo-1H-quinazolin-3-yl)-N-cyclooctylbutanamide?
4-(7-chloro-2,4-dioxo-1H-quinazolin-3-yl)-N-cyclooctylbutanamide has a molecular weight of 391.90 g/mol, XLogP of 3.35, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(7-chloro-2,4-dioxo-1H-quinazolin-3-yl)-N-cyclooctylbutanamide is sourced from PubChem (CID 6621547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).