About 3-phenyl-1,4-diazaspiro[4.4]non-3-en-2-one
3-phenyl-1,4-diazaspiro[4.4]non-3-en-2-one (PubChem CID 6621574) has the molecular formula C13H14N2O
and a molecular weight of 214.27 g/mol. Its IUPAC name is 3-phenyl-1,4-diazaspiro[4.4]non-3-en-2-one.
Molecular Properties
| Compound Name | 3-phenyl-1,4-diazaspiro[4.4]non-3-en-2-one |
| PubChem CID | 6621574 |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 3-phenyl-1,4-diazaspiro[4.4]non-3-en-2-one |
| SMILES | O=C1NC2(CCCC2)N=C1c1ccccc1 |
| InChI | InChI=1S/C13H14N2O/c16-12-11(10-6-2-1-3-7-10)14-13(15-12)8-4-5-9-13/h1-3,6-7H,4-5,8-9H2,(H,15,16) |
| InChIKey | SCYOIQHZNDYTFY-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-phenyl-1,4-diazaspiro[4.4]non-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-1,4-diazaspiro[4.4]non-3-en-2-one?
The IUPAC name of 3-phenyl-1,4-diazaspiro[4.4]non-3-en-2-one (CID 6621574) is 3-phenyl-1,4-diazaspiro[4.4]non-3-en-2-one.
What is the SMILES notation for 3-phenyl-1,4-diazaspiro[4.4]non-3-en-2-one?
The canonical SMILES for 3-phenyl-1,4-diazaspiro[4.4]non-3-en-2-one is O=C1NC2(CCCC2)N=C1c1ccccc1.
What is the InChIKey of 3-phenyl-1,4-diazaspiro[4.4]non-3-en-2-one?
The InChIKey is SCYOIQHZNDYTFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O/c16-12-11(10-6-2-1-3-7-10)14-13(15-12)8-4-5-9-13/h1-3,6-7H,4-5,8-9H2,(H,15,16).
What are the key properties of 3-phenyl-1,4-diazaspiro[4.4]non-3-en-2-one?
3-phenyl-1,4-diazaspiro[4.4]non-3-en-2-one has a molecular weight of 214.27 g/mol, XLogP of 1.88, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-1,4-diazaspiro[4.4]non-3-en-2-one is sourced from PubChem (CID 6621574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).