About N-[2-[4-(2-fluorophenyl)piperazin-1-yl]ethyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide
N-[2-[4-(2-fluorophenyl)piperazin-1-yl]ethyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide (PubChem CID 6621650) has the molecular formula C17H23FN4O3S
and a molecular weight of 382.46 g/mol. Its IUPAC name is N-[2-[4-(2-fluorophenyl)piperazin-1-yl]ethyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide.
Molecular Properties
| Compound Name | N-[2-[4-(2-fluorophenyl)piperazin-1-yl]ethyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
| PubChem CID | 6621650 |
| Molecular Formula | C17H23FN4O3S |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | N-[2-[4-(2-fluorophenyl)piperazin-1-yl]ethyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
| SMILES | Cc1noc(C)c1S(=O)(=O)NCCN1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C17H23FN4O3S/c1-13-17(14(2)25-20-13)26(23,24)19-7-8-21-9-11-22(12-10-21)16-6-4-3-5-15(16)18/h3-6,19H,7-12H2,1-2H3 |
| InChIKey | MSEDAPSOJUHACX-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 78.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[2-[4-(2-fluorophenyl)piperazin-1-yl]ethyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[4-(2-fluorophenyl)piperazin-1-yl]ethyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide?
The IUPAC name of N-[2-[4-(2-fluorophenyl)piperazin-1-yl]ethyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide (CID 6621650) is N-[2-[4-(2-fluorophenyl)piperazin-1-yl]ethyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide.
What is the SMILES notation for N-[2-[4-(2-fluorophenyl)piperazin-1-yl]ethyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide?
The canonical SMILES for N-[2-[4-(2-fluorophenyl)piperazin-1-yl]ethyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide is Cc1noc(C)c1S(=O)(=O)NCCN1CCN(c2ccccc2F)CC1.
What is the InChIKey of N-[2-[4-(2-fluorophenyl)piperazin-1-yl]ethyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide?
The InChIKey is MSEDAPSOJUHACX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23FN4O3S/c1-13-17(14(2)25-20-13)26(23,24)19-7-8-21-9-11-22(12-10-21)16-6-4-3-5-15(16)18/h3-6,19H,7-12H2,1-2H3.
What are the key properties of N-[2-[4-(2-fluorophenyl)piperazin-1-yl]ethyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide?
N-[2-[4-(2-fluorophenyl)piperazin-1-yl]ethyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide has a molecular weight of 382.46 g/mol, XLogP of 1.53, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[4-(2-fluorophenyl)piperazin-1-yl]ethyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide is sourced from PubChem (CID 6621650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).