About 4-(diethoxymethyl)-1-(2,2-difluoroethyl)triazole
4-(diethoxymethyl)-1-(2,2-difluoroethyl)triazole (PubChem CID 66216752) has the molecular formula C9H15F2N3O2
and a molecular weight of 235.23 g/mol. Its IUPAC name is 4-(diethoxymethyl)-1-(2,2-difluoroethyl)triazole.
Molecular Properties
| Compound Name | 4-(diethoxymethyl)-1-(2,2-difluoroethyl)triazole |
| PubChem CID | 66216752 |
| Molecular Formula | C9H15F2N3O2 |
| Molecular Weight | 235.23 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 4-(diethoxymethyl)-1-(2,2-difluoroethyl)triazole |
| SMILES | CCOC(OCC)c1cn(CC(F)F)nn1 |
| InChI | InChI=1S/C9H15F2N3O2/c1-3-15-9(16-4-2)7-5-14(13-12-7)6-8(10)11/h5,8-9H,3-4,6H2,1-2H3 |
| InChIKey | AOHOPXQUBQTGKD-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.23 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-(diethoxymethyl)-1-(2,2-difluoroethyl)triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(diethoxymethyl)-1-(2,2-difluoroethyl)triazole?
The IUPAC name of 4-(diethoxymethyl)-1-(2,2-difluoroethyl)triazole (CID 66216752) is 4-(diethoxymethyl)-1-(2,2-difluoroethyl)triazole.
What is the SMILES notation for 4-(diethoxymethyl)-1-(2,2-difluoroethyl)triazole?
The canonical SMILES for 4-(diethoxymethyl)-1-(2,2-difluoroethyl)triazole is CCOC(OCC)c1cn(CC(F)F)nn1.
What is the InChIKey of 4-(diethoxymethyl)-1-(2,2-difluoroethyl)triazole?
The InChIKey is AOHOPXQUBQTGKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F2N3O2/c1-3-15-9(16-4-2)7-5-14(13-12-7)6-8(10)11/h5,8-9H,3-4,6H2,1-2H3.
What are the key properties of 4-(diethoxymethyl)-1-(2,2-difluoroethyl)triazole?
4-(diethoxymethyl)-1-(2,2-difluoroethyl)triazole has a molecular weight of 235.23 g/mol, XLogP of 1.61, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(diethoxymethyl)-1-(2,2-difluoroethyl)triazole is sourced from PubChem (CID 66216752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).