C9H14N4OS — CID 66217003
2-(2-aminopropylsulfanyl)-N-pyrimidin-2-ylacetamide (PubChem CID 66217003) has the molecular formula C9H14N4OS and a molecular weight of 226.30 g/mol. Its IUPAC name is 2-(2-aminopropylsulfanyl)-N-pyrimidin-2-ylacetamide.
| Compound Name | 2-(2-aminopropylsulfanyl)-N-pyrimidin-2-ylacetamide |
|---|---|
| PubChem CID | 66217003 |
| Molecular Formula | C9H14N4OS |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 2-(2-aminopropylsulfanyl)-N-pyrimidin-2-ylacetamide |
| SMILES | CC(N)CSCC(=O)Nc1ncccn1 |
| InChI | InChI=1S/C9H14N4OS/c1-7(10)5-15-6-8(14)13-9-11-3-2-4-12-9/h2-4,7H,5-6,10H2,1H3,(H,11,12,13,14) |
| InChIKey | GPXQYFQJAZGNGF-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |