About 3-naphthalen-2-yl-1,4-thiazepane
3-naphthalen-2-yl-1,4-thiazepane (PubChem CID 66217047) has the molecular formula C15H17NS
and a molecular weight of 243.38 g/mol. Its IUPAC name is 3-naphthalen-2-yl-1,4-thiazepane.
Molecular Properties
| Compound Name | 3-naphthalen-2-yl-1,4-thiazepane |
| PubChem CID | 66217047 |
| Molecular Formula | C15H17NS |
| Molecular Weight | 243.38 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 3-naphthalen-2-yl-1,4-thiazepane |
| SMILES | c1ccc2cc(C3CSCCCN3)ccc2c1 |
| InChI | InChI=1S/C15H17NS/c1-2-5-13-10-14(7-6-12(13)4-1)15-11-17-9-3-8-16-15/h1-2,4-7,10,15-16H,3,8-9,11H2 |
| InChIKey | WANWMZBJFUVLNM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-naphthalen-2-yl-1,4-thiazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-naphthalen-2-yl-1,4-thiazepane?
The IUPAC name of 3-naphthalen-2-yl-1,4-thiazepane (CID 66217047) is 3-naphthalen-2-yl-1,4-thiazepane.
What is the SMILES notation for 3-naphthalen-2-yl-1,4-thiazepane?
The canonical SMILES for 3-naphthalen-2-yl-1,4-thiazepane is c1ccc2cc(C3CSCCCN3)ccc2c1.
What is the InChIKey of 3-naphthalen-2-yl-1,4-thiazepane?
The InChIKey is WANWMZBJFUVLNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NS/c1-2-5-13-10-14(7-6-12(13)4-1)15-11-17-9-3-8-16-15/h1-2,4-7,10,15-16H,3,8-9,11H2.
What are the key properties of 3-naphthalen-2-yl-1,4-thiazepane?
3-naphthalen-2-yl-1,4-thiazepane has a molecular weight of 243.38 g/mol, XLogP of 3.61, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-naphthalen-2-yl-1,4-thiazepane is sourced from PubChem (CID 66217047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).