About N-cycloheptyl-3,5-dimethyl-1,2-oxazole-4-sulfonamide
N-cycloheptyl-3,5-dimethyl-1,2-oxazole-4-sulfonamide (PubChem CID 6621710) has the molecular formula C12H20N2O3S
and a molecular weight of 272.37 g/mol. Its IUPAC name is N-cycloheptyl-3,5-dimethyl-1,2-oxazole-4-sulfonamide.
Molecular Properties
| Compound Name | N-cycloheptyl-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
| PubChem CID | 6621710 |
| Molecular Formula | C12H20N2O3S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | N-cycloheptyl-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
| SMILES | Cc1noc(C)c1S(=O)(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C12H20N2O3S/c1-9-12(10(2)17-13-9)18(15,16)14-11-7-5-3-4-6-8-11/h11,14H,3-8H2,1-2H3 |
| InChIKey | IDJMBJJDYXZWTD-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-cycloheptyl-3,5-dimethyl-1,2-oxazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cycloheptyl-3,5-dimethyl-1,2-oxazole-4-sulfonamide?
The IUPAC name of N-cycloheptyl-3,5-dimethyl-1,2-oxazole-4-sulfonamide (CID 6621710) is N-cycloheptyl-3,5-dimethyl-1,2-oxazole-4-sulfonamide.
What is the SMILES notation for N-cycloheptyl-3,5-dimethyl-1,2-oxazole-4-sulfonamide?
The canonical SMILES for N-cycloheptyl-3,5-dimethyl-1,2-oxazole-4-sulfonamide is Cc1noc(C)c1S(=O)(=O)NC1CCCCCC1.
What is the InChIKey of N-cycloheptyl-3,5-dimethyl-1,2-oxazole-4-sulfonamide?
The InChIKey is IDJMBJJDYXZWTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O3S/c1-9-12(10(2)17-13-9)18(15,16)14-11-7-5-3-4-6-8-11/h11,14H,3-8H2,1-2H3.
What are the key properties of N-cycloheptyl-3,5-dimethyl-1,2-oxazole-4-sulfonamide?
N-cycloheptyl-3,5-dimethyl-1,2-oxazole-4-sulfonamide has a molecular weight of 272.37 g/mol, XLogP of 2.29, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cycloheptyl-3,5-dimethyl-1,2-oxazole-4-sulfonamide is sourced from PubChem (CID 6621710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).