About 2-[(2,4-dichloro-6-methyl-3-pyridinyl)methylsulfanyl]propan-1-amine
2-[(2,4-dichloro-6-methyl-3-pyridinyl)methylsulfanyl]propan-1-amine (PubChem CID 66217376) has the molecular formula C10H14Cl2N2S
and a molecular weight of 265.21 g/mol. Its IUPAC name is 2-[(2,4-dichloro-6-methyl-3-pyridinyl)methylsulfanyl]propan-1-amine.
Molecular Properties
| Compound Name | 2-[(2,4-dichloro-6-methyl-3-pyridinyl)methylsulfanyl]propan-1-amine |
| PubChem CID | 66217376 |
| Molecular Formula | C10H14Cl2N2S |
| Molecular Weight | 265.21 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | 2-[(2,4-dichloro-6-methyl-3-pyridinyl)methylsulfanyl]propan-1-amine |
| SMILES | Cc1cc(Cl)c(CSC(C)CN)c(Cl)n1 |
| InChI | InChI=1S/C10H14Cl2N2S/c1-6-3-9(11)8(10(12)14-6)5-15-7(2)4-13/h3,7H,4-5,13H2,1-2H3 |
| InChIKey | PHWHNCSBEXUEKO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.21 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2,4-dichloro-6-methyl-3-pyridinyl)methylsulfanyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,4-dichloro-6-methyl-3-pyridinyl)methylsulfanyl]propan-1-amine?
The IUPAC name of 2-[(2,4-dichloro-6-methyl-3-pyridinyl)methylsulfanyl]propan-1-amine (CID 66217376) is 2-[(2,4-dichloro-6-methyl-3-pyridinyl)methylsulfanyl]propan-1-amine.
What is the SMILES notation for 2-[(2,4-dichloro-6-methyl-3-pyridinyl)methylsulfanyl]propan-1-amine?
The canonical SMILES for 2-[(2,4-dichloro-6-methyl-3-pyridinyl)methylsulfanyl]propan-1-amine is Cc1cc(Cl)c(CSC(C)CN)c(Cl)n1.
What is the InChIKey of 2-[(2,4-dichloro-6-methyl-3-pyridinyl)methylsulfanyl]propan-1-amine?
The InChIKey is PHWHNCSBEXUEKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14Cl2N2S/c1-6-3-9(11)8(10(12)14-6)5-15-7(2)4-13/h3,7H,4-5,13H2,1-2H3.
What are the key properties of 2-[(2,4-dichloro-6-methyl-3-pyridinyl)methylsulfanyl]propan-1-amine?
2-[(2,4-dichloro-6-methyl-3-pyridinyl)methylsulfanyl]propan-1-amine has a molecular weight of 265.21 g/mol, XLogP of 3.28, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,4-dichloro-6-methyl-3-pyridinyl)methylsulfanyl]propan-1-amine is sourced from PubChem (CID 66217376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).