C10H16F3NOS — CID 66217783
8-(trifluoromethyl)-2,3,4,5,5a,6,7,8,9,9a-decahydrobenzo[b][1,4]thiazepine 1-oxide (PubChem CID 66217783) has the molecular formula C10H16F3NOS and a molecular weight of 255.30 g/mol. Its IUPAC name is 8-(trifluoromethyl)-2,3,4,5,5a,6,7,8,9,9a-decahydrobenzo[b][1,4]thiazepine 1-oxide.
| Compound Name | 8-(trifluoromethyl)-2,3,4,5,5a,6,7,8,9,9a-decahydrobenzo[b][1,4]thiazepine 1-oxide |
|---|---|
| PubChem CID | 66217783 |
| Molecular Formula | C10H16F3NOS |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 8-(trifluoromethyl)-2,3,4,5,5a,6,7,8,9,9a-decahydrobenzo[b][1,4]thiazepine 1-oxide |
| SMILES | O=S1CCCNC2CCC(C(F)(F)F)CC21 |
| InChI | InChI=1S/C10H16F3NOS/c11-10(12,13)7-2-3-8-9(6-7)16(15)5-1-4-14-8/h7-9,14H,1-6H2 |
| InChIKey | WTKSIEIJQZNIRC-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |