About 2-cyclohex-3-en-1-yl-1,3-thiazinane
2-cyclohex-3-en-1-yl-1,3-thiazinane (PubChem CID 66218259) has the molecular formula C10H17NS
and a molecular weight of 183.32 g/mol. Its IUPAC name is 2-cyclohex-3-en-1-yl-1,3-thiazinane.
Molecular Properties
| Compound Name | 2-cyclohex-3-en-1-yl-1,3-thiazinane |
| PubChem CID | 66218259 |
| Molecular Formula | C10H17NS |
| Molecular Weight | 183.32 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | 2-cyclohex-3-en-1-yl-1,3-thiazinane |
| SMILES | C1=CCC(C2NCCCS2)CC1 |
| InChI | InChI=1S/C10H17NS/c1-2-5-9(6-3-1)10-11-7-4-8-12-10/h1-2,9-11H,3-8H2 |
| InChIKey | AUGJBJCDHQRKQZ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohex-3-en-1-yl-1,3-thiazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohex-3-en-1-yl-1,3-thiazinane?
The IUPAC name of 2-cyclohex-3-en-1-yl-1,3-thiazinane (CID 66218259) is 2-cyclohex-3-en-1-yl-1,3-thiazinane.
What is the SMILES notation for 2-cyclohex-3-en-1-yl-1,3-thiazinane?
The canonical SMILES for 2-cyclohex-3-en-1-yl-1,3-thiazinane is C1=CCC(C2NCCCS2)CC1.
What is the InChIKey of 2-cyclohex-3-en-1-yl-1,3-thiazinane?
The InChIKey is AUGJBJCDHQRKQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NS/c1-2-5-9(6-3-1)10-11-7-4-8-12-10/h1-2,9-11H,3-8H2.
What are the key properties of 2-cyclohex-3-en-1-yl-1,3-thiazinane?
2-cyclohex-3-en-1-yl-1,3-thiazinane has a molecular weight of 183.32 g/mol, XLogP of 2.40, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohex-3-en-1-yl-1,3-thiazinane is sourced from PubChem (CID 66218259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).