About 2-naphthalen-2-yl-1,3-thiazinane
2-naphthalen-2-yl-1,3-thiazinane (PubChem CID 66218515) has the molecular formula C14H15NS
and a molecular weight of 229.35 g/mol. Its IUPAC name is 2-naphthalen-2-yl-1,3-thiazinane.
Molecular Properties
| Compound Name | 2-naphthalen-2-yl-1,3-thiazinane |
| PubChem CID | 66218515 |
| Molecular Formula | C14H15NS |
| Molecular Weight | 229.35 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2-naphthalen-2-yl-1,3-thiazinane |
| SMILES | c1ccc2cc(C3NCCCS3)ccc2c1 |
| InChI | InChI=1S/C14H15NS/c1-2-5-12-10-13(7-6-11(12)4-1)14-15-8-3-9-16-14/h1-2,4-7,10,14-15H,3,8-9H2 |
| InChIKey | KNWMSCCBESSGSZ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.35 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-naphthalen-2-yl-1,3-thiazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-naphthalen-2-yl-1,3-thiazinane?
The IUPAC name of 2-naphthalen-2-yl-1,3-thiazinane (CID 66218515) is 2-naphthalen-2-yl-1,3-thiazinane.
What is the SMILES notation for 2-naphthalen-2-yl-1,3-thiazinane?
The canonical SMILES for 2-naphthalen-2-yl-1,3-thiazinane is c1ccc2cc(C3NCCCS3)ccc2c1.
What is the InChIKey of 2-naphthalen-2-yl-1,3-thiazinane?
The InChIKey is KNWMSCCBESSGSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NS/c1-2-5-12-10-13(7-6-11(12)4-1)14-15-8-3-9-16-14/h1-2,4-7,10,14-15H,3,8-9H2.
What are the key properties of 2-naphthalen-2-yl-1,3-thiazinane?
2-naphthalen-2-yl-1,3-thiazinane has a molecular weight of 229.35 g/mol, XLogP of 3.56, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-naphthalen-2-yl-1,3-thiazinane is sourced from PubChem (CID 66218515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).