About 2-chloro-4-(1,3-thiazinan-2-yl)phenol
2-chloro-4-(1,3-thiazinan-2-yl)phenol (PubChem CID 66218518) has the molecular formula C10H12ClNOS
and a molecular weight of 229.73 g/mol. Its IUPAC name is 2-chloro-4-(1,3-thiazinan-2-yl)phenol.
Molecular Properties
| Compound Name | 2-chloro-4-(1,3-thiazinan-2-yl)phenol |
| PubChem CID | 66218518 |
| Molecular Formula | C10H12ClNOS |
| Molecular Weight | 229.73 g/mol |
| Exact Mass | 229.03 |
| IUPAC Name | 2-chloro-4-(1,3-thiazinan-2-yl)phenol |
| SMILES | Oc1ccc(C2NCCCS2)cc1Cl |
| InChI | InChI=1S/C10H12ClNOS/c11-8-6-7(2-3-9(8)13)10-12-4-1-5-14-10/h2-3,6,10,12-13H,1,4-5H2 |
| InChIKey | OOUARBPXSVXGIV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.73 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-chloro-4-(1,3-thiazinan-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-(1,3-thiazinan-2-yl)phenol?
The IUPAC name of 2-chloro-4-(1,3-thiazinan-2-yl)phenol (CID 66218518) is 2-chloro-4-(1,3-thiazinan-2-yl)phenol.
What is the SMILES notation for 2-chloro-4-(1,3-thiazinan-2-yl)phenol?
The canonical SMILES for 2-chloro-4-(1,3-thiazinan-2-yl)phenol is Oc1ccc(C2NCCCS2)cc1Cl.
What is the InChIKey of 2-chloro-4-(1,3-thiazinan-2-yl)phenol?
The InChIKey is OOUARBPXSVXGIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12ClNOS/c11-8-6-7(2-3-9(8)13)10-12-4-1-5-14-10/h2-3,6,10,12-13H,1,4-5H2.
What are the key properties of 2-chloro-4-(1,3-thiazinan-2-yl)phenol?
2-chloro-4-(1,3-thiazinan-2-yl)phenol has a molecular weight of 229.73 g/mol, XLogP of 2.77, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-(1,3-thiazinan-2-yl)phenol is sourced from PubChem (CID 66218518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).