C11H21NS — CID 66219007
7,9-dimethyl-2,3,4,5,5a,6,7,8,9,9a-decahydrobenzo[b][1,4]thiazepine (PubChem CID 66219007) has the molecular formula C11H21NS and a molecular weight of 199.36 g/mol. Its IUPAC name is 7,9-dimethyl-2,3,4,5,5a,6,7,8,9,9a-decahydrobenzo[b][1,4]thiazepine.
| Compound Name | 7,9-dimethyl-2,3,4,5,5a,6,7,8,9,9a-decahydrobenzo[b][1,4]thiazepine |
|---|---|
| PubChem CID | 66219007 |
| Molecular Formula | C11H21NS |
| Molecular Weight | 199.36 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | 7,9-dimethyl-2,3,4,5,5a,6,7,8,9,9a-decahydrobenzo[b][1,4]thiazepine |
| SMILES | CC1CC(C)C2SCCCNC2C1 |
| InChI | InChI=1S/C11H21NS/c1-8-6-9(2)11-10(7-8)12-4-3-5-13-11/h8-12H,3-7H2,1-2H3 |
| InChIKey | OMAQXCDKGCGMRZ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |