About 3-[(2-methyl-1,3-thiazol-5-yl)methylsulfanyl]propan-1-amine
3-[(2-methyl-1,3-thiazol-5-yl)methylsulfanyl]propan-1-amine (PubChem CID 66219056) has the molecular formula C8H14N2S2
and a molecular weight of 202.35 g/mol. Its IUPAC name is 3-[(2-methyl-1,3-thiazol-5-yl)methylsulfanyl]propan-1-amine.
Molecular Properties
| Compound Name | 3-[(2-methyl-1,3-thiazol-5-yl)methylsulfanyl]propan-1-amine |
| PubChem CID | 66219056 |
| Molecular Formula | C8H14N2S2 |
| Molecular Weight | 202.35 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | 3-[(2-methyl-1,3-thiazol-5-yl)methylsulfanyl]propan-1-amine |
| SMILES | Cc1ncc(CSCCCN)s1 |
| InChI | InChI=1S/C8H14N2S2/c1-7-10-5-8(12-7)6-11-4-2-3-9/h5H,2-4,6,9H2,1H3 |
| InChIKey | KBCLKGQBKYAJMT-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.35 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2-methyl-1,3-thiazol-5-yl)methylsulfanyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-methyl-1,3-thiazol-5-yl)methylsulfanyl]propan-1-amine?
The IUPAC name of 3-[(2-methyl-1,3-thiazol-5-yl)methylsulfanyl]propan-1-amine (CID 66219056) is 3-[(2-methyl-1,3-thiazol-5-yl)methylsulfanyl]propan-1-amine.
What is the SMILES notation for 3-[(2-methyl-1,3-thiazol-5-yl)methylsulfanyl]propan-1-amine?
The canonical SMILES for 3-[(2-methyl-1,3-thiazol-5-yl)methylsulfanyl]propan-1-amine is Cc1ncc(CSCCCN)s1.
What is the InChIKey of 3-[(2-methyl-1,3-thiazol-5-yl)methylsulfanyl]propan-1-amine?
The InChIKey is KBCLKGQBKYAJMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2S2/c1-7-10-5-8(12-7)6-11-4-2-3-9/h5H,2-4,6,9H2,1H3.
What are the key properties of 3-[(2-methyl-1,3-thiazol-5-yl)methylsulfanyl]propan-1-amine?
3-[(2-methyl-1,3-thiazol-5-yl)methylsulfanyl]propan-1-amine has a molecular weight of 202.35 g/mol, XLogP of 2.03, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-methyl-1,3-thiazol-5-yl)methylsulfanyl]propan-1-amine is sourced from PubChem (CID 66219056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).