About 2-(3-phenoxyphenyl)-1,3-thiazinane
2-(3-phenoxyphenyl)-1,3-thiazinane (PubChem CID 66219243) has the molecular formula C16H17NOS
and a molecular weight of 271.39 g/mol. Its IUPAC name is 2-(3-phenoxyphenyl)-1,3-thiazinane.
Molecular Properties
| Compound Name | 2-(3-phenoxyphenyl)-1,3-thiazinane |
| PubChem CID | 66219243 |
| Molecular Formula | C16H17NOS |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 2-(3-phenoxyphenyl)-1,3-thiazinane |
| SMILES | c1ccc(Oc2cccc(C3NCCCS3)c2)cc1 |
| InChI | InChI=1S/C16H17NOS/c1-2-7-14(8-3-1)18-15-9-4-6-13(12-15)16-17-10-5-11-19-16/h1-4,6-9,12,16-17H,5,10-11H2 |
| InChIKey | LFJBTSBZGRXJJN-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3-phenoxyphenyl)-1,3-thiazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-phenoxyphenyl)-1,3-thiazinane?
The IUPAC name of 2-(3-phenoxyphenyl)-1,3-thiazinane (CID 66219243) is 2-(3-phenoxyphenyl)-1,3-thiazinane.
What is the SMILES notation for 2-(3-phenoxyphenyl)-1,3-thiazinane?
The canonical SMILES for 2-(3-phenoxyphenyl)-1,3-thiazinane is c1ccc(Oc2cccc(C3NCCCS3)c2)cc1.
What is the InChIKey of 2-(3-phenoxyphenyl)-1,3-thiazinane?
The InChIKey is LFJBTSBZGRXJJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NOS/c1-2-7-14(8-3-1)18-15-9-4-6-13(12-15)16-17-10-5-11-19-16/h1-4,6-9,12,16-17H,5,10-11H2.
What are the key properties of 2-(3-phenoxyphenyl)-1,3-thiazinane?
2-(3-phenoxyphenyl)-1,3-thiazinane has a molecular weight of 271.39 g/mol, XLogP of 4.20, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-phenoxyphenyl)-1,3-thiazinane is sourced from PubChem (CID 66219243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).