About 3-(3,4-dichlorophenyl)-1,4-thiazepane
3-(3,4-dichlorophenyl)-1,4-thiazepane (PubChem CID 66219260) has the molecular formula C11H13Cl2NS
and a molecular weight of 262.20 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-1,4-thiazepane.
Molecular Properties
| Compound Name | 3-(3,4-dichlorophenyl)-1,4-thiazepane |
| PubChem CID | 66219260 |
| Molecular Formula | C11H13Cl2NS |
| Molecular Weight | 262.20 g/mol |
| Exact Mass | 261.01 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-1,4-thiazepane |
| SMILES | Clc1ccc(C2CSCCCN2)cc1Cl |
| InChI | InChI=1S/C11H13Cl2NS/c12-9-3-2-8(6-10(9)13)11-7-15-5-1-4-14-11/h2-3,6,11,14H,1,4-5,7H2 |
| InChIKey | VEFAPNMKVWLSLC-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.20 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(3,4-dichlorophenyl)-1,4-thiazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dichlorophenyl)-1,4-thiazepane?
The IUPAC name of 3-(3,4-dichlorophenyl)-1,4-thiazepane (CID 66219260) is 3-(3,4-dichlorophenyl)-1,4-thiazepane.
What is the SMILES notation for 3-(3,4-dichlorophenyl)-1,4-thiazepane?
The canonical SMILES for 3-(3,4-dichlorophenyl)-1,4-thiazepane is Clc1ccc(C2CSCCCN2)cc1Cl.
What is the InChIKey of 3-(3,4-dichlorophenyl)-1,4-thiazepane?
The InChIKey is VEFAPNMKVWLSLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13Cl2NS/c12-9-3-2-8(6-10(9)13)11-7-15-5-1-4-14-11/h2-3,6,11,14H,1,4-5,7H2.
What are the key properties of 3-(3,4-dichlorophenyl)-1,4-thiazepane?
3-(3,4-dichlorophenyl)-1,4-thiazepane has a molecular weight of 262.20 g/mol, XLogP of 3.76, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dichlorophenyl)-1,4-thiazepane is sourced from PubChem (CID 66219260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).