About 3-(1-adamantyl)-1,4-thiazepane 1-oxide
3-(1-adamantyl)-1,4-thiazepane 1-oxide (PubChem CID 66219264) has the molecular formula C15H25NOS
and a molecular weight of 267.44 g/mol. Its IUPAC name is 3-(1-adamantyl)-1,4-thiazepane 1-oxide.
Molecular Properties
| Compound Name | 3-(1-adamantyl)-1,4-thiazepane 1-oxide |
| PubChem CID | 66219264 |
| Molecular Formula | C15H25NOS |
| Molecular Weight | 267.44 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 3-(1-adamantyl)-1,4-thiazepane 1-oxide |
| SMILES | O=S1CCCNC(C23CC4CC(CC(C4)C2)C3)C1 |
| InChI | InChI=1S/C15H25NOS/c17-18-3-1-2-16-14(10-18)15-7-11-4-12(8-15)6-13(5-11)9-15/h11-14,16H,1-10H2 |
| InChIKey | LPGDHFXSYBZSGD-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.44 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(1-adamantyl)-1,4-thiazepane 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-adamantyl)-1,4-thiazepane 1-oxide?
The IUPAC name of 3-(1-adamantyl)-1,4-thiazepane 1-oxide (CID 66219264) is 3-(1-adamantyl)-1,4-thiazepane 1-oxide.
What is the SMILES notation for 3-(1-adamantyl)-1,4-thiazepane 1-oxide?
The canonical SMILES for 3-(1-adamantyl)-1,4-thiazepane 1-oxide is O=S1CCCNC(C23CC4CC(CC(C4)C2)C3)C1.
What is the InChIKey of 3-(1-adamantyl)-1,4-thiazepane 1-oxide?
The InChIKey is LPGDHFXSYBZSGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25NOS/c17-18-3-1-2-16-14(10-18)15-7-11-4-12(8-15)6-13(5-11)9-15/h11-14,16H,1-10H2.
What are the key properties of 3-(1-adamantyl)-1,4-thiazepane 1-oxide?
3-(1-adamantyl)-1,4-thiazepane 1-oxide has a molecular weight of 267.44 g/mol, XLogP of 2.31, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-adamantyl)-1,4-thiazepane 1-oxide is sourced from PubChem (CID 66219264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).