About 2-(4-chloro-3-fluorophenyl)-1,3-thiazinane
2-(4-chloro-3-fluorophenyl)-1,3-thiazinane (PubChem CID 66219496) has the molecular formula C10H11ClFNS
and a molecular weight of 231.72 g/mol. Its IUPAC name is 2-(4-chloro-3-fluorophenyl)-1,3-thiazinane.
Molecular Properties
| Compound Name | 2-(4-chloro-3-fluorophenyl)-1,3-thiazinane |
| PubChem CID | 66219496 |
| Molecular Formula | C10H11ClFNS |
| Molecular Weight | 231.72 g/mol |
| Exact Mass | 231.03 |
| IUPAC Name | 2-(4-chloro-3-fluorophenyl)-1,3-thiazinane |
| SMILES | Fc1cc(C2NCCCS2)ccc1Cl |
| InChI | InChI=1S/C10H11ClFNS/c11-8-3-2-7(6-9(8)12)10-13-4-1-5-14-10/h2-3,6,10,13H,1,4-5H2 |
| InChIKey | PCWREHGRWFEYAG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.72 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-chloro-3-fluorophenyl)-1,3-thiazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chloro-3-fluorophenyl)-1,3-thiazinane?
The IUPAC name of 2-(4-chloro-3-fluorophenyl)-1,3-thiazinane (CID 66219496) is 2-(4-chloro-3-fluorophenyl)-1,3-thiazinane.
What is the SMILES notation for 2-(4-chloro-3-fluorophenyl)-1,3-thiazinane?
The canonical SMILES for 2-(4-chloro-3-fluorophenyl)-1,3-thiazinane is Fc1cc(C2NCCCS2)ccc1Cl.
What is the InChIKey of 2-(4-chloro-3-fluorophenyl)-1,3-thiazinane?
The InChIKey is PCWREHGRWFEYAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClFNS/c11-8-3-2-7(6-9(8)12)10-13-4-1-5-14-10/h2-3,6,10,13H,1,4-5H2.
What are the key properties of 2-(4-chloro-3-fluorophenyl)-1,3-thiazinane?
2-(4-chloro-3-fluorophenyl)-1,3-thiazinane has a molecular weight of 231.72 g/mol, XLogP of 3.20, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chloro-3-fluorophenyl)-1,3-thiazinane is sourced from PubChem (CID 66219496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).