C13H16N2OS — CID 66220273
3-[(5-phenyl-1,2-oxazol-3-yl)methylsulfanyl]propan-1-amine (PubChem CID 66220273) has the molecular formula C13H16N2OS and a molecular weight of 248.35 g/mol. Its IUPAC name is 3-[(5-phenyl-1,2-oxazol-3-yl)methylsulfanyl]propan-1-amine.
| Compound Name | 3-[(5-phenyl-1,2-oxazol-3-yl)methylsulfanyl]propan-1-amine |
|---|---|
| PubChem CID | 66220273 |
| Molecular Formula | C13H16N2OS |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 3-[(5-phenyl-1,2-oxazol-3-yl)methylsulfanyl]propan-1-amine |
| SMILES | NCCCSCc1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C13H16N2OS/c14-7-4-8-17-10-12-9-13(16-15-12)11-5-2-1-3-6-11/h1-3,5-6,9H,4,7-8,10,14H2 |
| InChIKey | NIROHMCJEPCLAH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|