C10H22N2O2 — CID 66221021
1-(2,2-dimethoxyethyl)-4-ethylpiperazine (PubChem CID 66221021) has the molecular formula C10H22N2O2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 1-(2,2-dimethoxyethyl)-4-ethylpiperazine.
| Compound Name | 1-(2,2-dimethoxyethyl)-4-ethylpiperazine |
|---|---|
| PubChem CID | 66221021 |
| Molecular Formula | C10H22N2O2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | 1-(2,2-dimethoxyethyl)-4-ethylpiperazine |
| SMILES | CCN1CCN(CC(OC)OC)CC1 |
| InChI | InChI=1S/C10H22N2O2/c1-4-11-5-7-12(8-6-11)9-10(13-2)14-3/h10H,4-9H2,1-3H3 |
| InChIKey | SHBHKSSDFZPIGX-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|