About 1-[(2,4-dinitrophenyl)methyl]-2,2-dimethylpiperazine
1-[(2,4-dinitrophenyl)methyl]-2,2-dimethylpiperazine (PubChem CID 66221367) has the molecular formula C13H18N4O4
and a molecular weight of 294.31 g/mol. Its IUPAC name is 1-[(2,4-dinitrophenyl)methyl]-2,2-dimethylpiperazine.
Molecular Properties
| Compound Name | 1-[(2,4-dinitrophenyl)methyl]-2,2-dimethylpiperazine |
| PubChem CID | 66221367 |
| Molecular Formula | C13H18N4O4 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 1-[(2,4-dinitrophenyl)methyl]-2,2-dimethylpiperazine |
| SMILES | CC1(C)CNCCN1Cc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H18N4O4/c1-13(2)9-14-5-6-15(13)8-10-3-4-11(16(18)19)7-12(10)17(20)21/h3-4,7,14H,5-6,8-9H2,1-2H3 |
| InChIKey | WSCHBIFOXIPGCK-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2,4-dinitrophenyl)methyl]-2,2-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,4-dinitrophenyl)methyl]-2,2-dimethylpiperazine?
The IUPAC name of 1-[(2,4-dinitrophenyl)methyl]-2,2-dimethylpiperazine (CID 66221367) is 1-[(2,4-dinitrophenyl)methyl]-2,2-dimethylpiperazine.
What is the SMILES notation for 1-[(2,4-dinitrophenyl)methyl]-2,2-dimethylpiperazine?
The canonical SMILES for 1-[(2,4-dinitrophenyl)methyl]-2,2-dimethylpiperazine is CC1(C)CNCCN1Cc1ccc([N+](=O)[O-])cc1[N+](=O)[O-].
What is the InChIKey of 1-[(2,4-dinitrophenyl)methyl]-2,2-dimethylpiperazine?
The InChIKey is WSCHBIFOXIPGCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4O4/c1-13(2)9-14-5-6-15(13)8-10-3-4-11(16(18)19)7-12(10)17(20)21/h3-4,7,14H,5-6,8-9H2,1-2H3.
What are the key properties of 1-[(2,4-dinitrophenyl)methyl]-2,2-dimethylpiperazine?
1-[(2,4-dinitrophenyl)methyl]-2,2-dimethylpiperazine has a molecular weight of 294.31 g/mol, XLogP of 1.69, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,4-dinitrophenyl)methyl]-2,2-dimethylpiperazine is sourced from PubChem (CID 66221367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).