C10H12BrNO5 — CID 66221494
4-bromo-1-(2,2-dimethoxyethoxy)-2-nitrobenzene (PubChem CID 66221494) has the molecular formula C10H12BrNO5 and a molecular weight of 306.11 g/mol. Its IUPAC name is 4-bromo-1-(2,2-dimethoxyethoxy)-2-nitrobenzene.
| Compound Name | 4-bromo-1-(2,2-dimethoxyethoxy)-2-nitrobenzene |
|---|---|
| PubChem CID | 66221494 |
| Molecular Formula | C10H12BrNO5 |
| Molecular Weight | 306.11 g/mol |
| Exact Mass | 304.99 |
| IUPAC Name | 4-bromo-1-(2,2-dimethoxyethoxy)-2-nitrobenzene |
| SMILES | COC(COc1ccc(Br)cc1[N+](=O)[O-])OC |
| InChI | InChI=1S/C10H12BrNO5/c1-15-10(16-2)6-17-9-4-3-7(11)5-8(9)12(13)14/h3-5,10H,6H2,1-2H3 |
| InChIKey | MLEMVRXHUXABGD-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.11 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|