About 2-[2,2-dimethoxyethyl(propyl)amino]-N,N-dimethylacetamide
2-[2,2-dimethoxyethyl(propyl)amino]-N,N-dimethylacetamide (PubChem CID 66221703) has the molecular formula C11H24N2O3
and a molecular weight of 232.32 g/mol. Its IUPAC name is 2-[2,2-dimethoxyethyl(propyl)amino]-N,N-dimethylacetamide.
Molecular Properties
| Compound Name | 2-[2,2-dimethoxyethyl(propyl)amino]-N,N-dimethylacetamide |
| PubChem CID | 66221703 |
| Molecular Formula | C11H24N2O3 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | 2-[2,2-dimethoxyethyl(propyl)amino]-N,N-dimethylacetamide |
| SMILES | CCCN(CC(=O)N(C)C)CC(OC)OC |
| InChI | InChI=1S/C11H24N2O3/c1-6-7-13(8-10(14)12(2)3)9-11(15-4)16-5/h11H,6-9H2,1-5H3 |
| InChIKey | JSWVUYPTKXNKTI-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-[2,2-dimethoxyethyl(propyl)amino]-N,N-dimethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,2-dimethoxyethyl(propyl)amino]-N,N-dimethylacetamide?
The IUPAC name of 2-[2,2-dimethoxyethyl(propyl)amino]-N,N-dimethylacetamide (CID 66221703) is 2-[2,2-dimethoxyethyl(propyl)amino]-N,N-dimethylacetamide.
What is the SMILES notation for 2-[2,2-dimethoxyethyl(propyl)amino]-N,N-dimethylacetamide?
The canonical SMILES for 2-[2,2-dimethoxyethyl(propyl)amino]-N,N-dimethylacetamide is CCCN(CC(=O)N(C)C)CC(OC)OC.
What is the InChIKey of 2-[2,2-dimethoxyethyl(propyl)amino]-N,N-dimethylacetamide?
The InChIKey is JSWVUYPTKXNKTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N2O3/c1-6-7-13(8-10(14)12(2)3)9-11(15-4)16-5/h11H,6-9H2,1-5H3.
What are the key properties of 2-[2,2-dimethoxyethyl(propyl)amino]-N,N-dimethylacetamide?
2-[2,2-dimethoxyethyl(propyl)amino]-N,N-dimethylacetamide has a molecular weight of 232.32 g/mol, XLogP of 0.41, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,2-dimethoxyethyl(propyl)amino]-N,N-dimethylacetamide is sourced from PubChem (CID 66221703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).