About 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-benzyl-3-phenylpropanamide
2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-benzyl-3-phenylpropanamide (PubChem CID 6622198) has the molecular formula C22H20N4O3S2
and a molecular weight of 452.56 g/mol. Its IUPAC name is 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-benzyl-3-phenylpropanamide.
Molecular Properties
| Compound Name | 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-benzyl-3-phenylpropanamide |
| PubChem CID | 6622198 |
| Molecular Formula | C22H20N4O3S2 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-benzyl-3-phenylpropanamide |
| SMILES | O=C(NCc1ccccc1)C(Cc1ccccc1)NS(=O)(=O)c1cccc2nsnc12 |
| InChI | InChI=1S/C22H20N4O3S2/c27-22(23-15-17-10-5-2-6-11-17)19(14-16-8-3-1-4-9-16)26-31(28,29)20-13-7-12-18-21(20)25-30-24-18/h1-13,19,26H,14-15H2,(H,23,27) |
| InChIKey | NQVUMPXLNWFGQM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-benzyl-3-phenylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-benzyl-3-phenylpropanamide?
The IUPAC name of 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-benzyl-3-phenylpropanamide (CID 6622198) is 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-benzyl-3-phenylpropanamide.
What is the SMILES notation for 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-benzyl-3-phenylpropanamide?
The canonical SMILES for 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-benzyl-3-phenylpropanamide is O=C(NCc1ccccc1)C(Cc1ccccc1)NS(=O)(=O)c1cccc2nsnc12.
What is the InChIKey of 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-benzyl-3-phenylpropanamide?
The InChIKey is NQVUMPXLNWFGQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N4O3S2/c27-22(23-15-17-10-5-2-6-11-17)19(14-16-8-3-1-4-9-16)26-31(28,29)20-13-7-12-18-21(20)25-30-24-18/h1-13,19,26H,14-15H2,(H,23,27).
What are the key properties of 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-benzyl-3-phenylpropanamide?
2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-benzyl-3-phenylpropanamide has a molecular weight of 452.56 g/mol, XLogP of 2.90, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-benzyl-3-phenylpropanamide is sourced from PubChem (CID 6622198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).