About 4-(5-iodo-2-oxo-1,3-thiazol-3-yl)butanoic acid
4-(5-iodo-2-oxo-1,3-thiazol-3-yl)butanoic acid (PubChem CID 66222182) has the molecular formula C7H8INO3S
and a molecular weight of 313.12 g/mol. Its IUPAC name is 4-(5-iodo-2-oxo-1,3-thiazol-3-yl)butanoic acid.
Molecular Properties
| Compound Name | 4-(5-iodo-2-oxo-1,3-thiazol-3-yl)butanoic acid |
| PubChem CID | 66222182 |
| Molecular Formula | C7H8INO3S |
| Molecular Weight | 313.12 g/mol |
| Exact Mass | 312.93 |
| IUPAC Name | 4-(5-iodo-2-oxo-1,3-thiazol-3-yl)butanoic acid |
| SMILES | O=C(O)CCCn1cc(I)sc1=O |
| InChI | InChI=1S/C7H8INO3S/c8-5-4-9(7(12)13-5)3-1-2-6(10)11/h4H,1-3H2,(H,10,11) |
| InChIKey | QHFXCNAAIWOJTD-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.12 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-(5-iodo-2-oxo-1,3-thiazol-3-yl)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-iodo-2-oxo-1,3-thiazol-3-yl)butanoic acid?
The IUPAC name of 4-(5-iodo-2-oxo-1,3-thiazol-3-yl)butanoic acid (CID 66222182) is 4-(5-iodo-2-oxo-1,3-thiazol-3-yl)butanoic acid.
What is the SMILES notation for 4-(5-iodo-2-oxo-1,3-thiazol-3-yl)butanoic acid?
The canonical SMILES for 4-(5-iodo-2-oxo-1,3-thiazol-3-yl)butanoic acid is O=C(O)CCCn1cc(I)sc1=O.
What is the InChIKey of 4-(5-iodo-2-oxo-1,3-thiazol-3-yl)butanoic acid?
The InChIKey is QHFXCNAAIWOJTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8INO3S/c8-5-4-9(7(12)13-5)3-1-2-6(10)11/h4H,1-3H2,(H,10,11).
What are the key properties of 4-(5-iodo-2-oxo-1,3-thiazol-3-yl)butanoic acid?
4-(5-iodo-2-oxo-1,3-thiazol-3-yl)butanoic acid has a molecular weight of 313.12 g/mol, XLogP of 1.38, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-iodo-2-oxo-1,3-thiazol-3-yl)butanoic acid is sourced from PubChem (CID 66222182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).