About N-butyl-N-(2,2-dimethoxyethyl)cyclopropanamine
N-butyl-N-(2,2-dimethoxyethyl)cyclopropanamine (PubChem CID 66222322) has the molecular formula C11H23NO2
and a molecular weight of 201.31 g/mol. Its IUPAC name is N-butyl-N-(2,2-dimethoxyethyl)cyclopropanamine.
Molecular Properties
| Compound Name | N-butyl-N-(2,2-dimethoxyethyl)cyclopropanamine |
| PubChem CID | 66222322 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | N-butyl-N-(2,2-dimethoxyethyl)cyclopropanamine |
| SMILES | CCCCN(CC(OC)OC)C1CC1 |
| InChI | InChI=1S/C11H23NO2/c1-4-5-8-12(10-6-7-10)9-11(13-2)14-3/h10-11H,4-9H2,1-3H3 |
| InChIKey | ARKIFKGXAXCXHU-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-N-(2,2-dimethoxyethyl)cyclopropanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N-(2,2-dimethoxyethyl)cyclopropanamine?
The IUPAC name of N-butyl-N-(2,2-dimethoxyethyl)cyclopropanamine (CID 66222322) is N-butyl-N-(2,2-dimethoxyethyl)cyclopropanamine.
What is the SMILES notation for N-butyl-N-(2,2-dimethoxyethyl)cyclopropanamine?
The canonical SMILES for N-butyl-N-(2,2-dimethoxyethyl)cyclopropanamine is CCCCN(CC(OC)OC)C1CC1.
What is the InChIKey of N-butyl-N-(2,2-dimethoxyethyl)cyclopropanamine?
The InChIKey is ARKIFKGXAXCXHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO2/c1-4-5-8-12(10-6-7-10)9-11(13-2)14-3/h10-11H,4-9H2,1-3H3.
What are the key properties of N-butyl-N-(2,2-dimethoxyethyl)cyclopropanamine?
N-butyl-N-(2,2-dimethoxyethyl)cyclopropanamine has a molecular weight of 201.31 g/mol, XLogP of 1.87, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N-(2,2-dimethoxyethyl)cyclopropanamine is sourced from PubChem (CID 66222322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).