About 2-[2,2-dimethoxyethyl(2-hydroxyethyl)amino]ethanol
2-[2,2-dimethoxyethyl(2-hydroxyethyl)amino]ethanol (PubChem CID 66222761) has the molecular formula C8H19NO4
and a molecular weight of 193.24 g/mol. Its IUPAC name is 2-[2,2-dimethoxyethyl(2-hydroxyethyl)amino]ethanol.
Molecular Properties
| Compound Name | 2-[2,2-dimethoxyethyl(2-hydroxyethyl)amino]ethanol |
| PubChem CID | 66222761 |
| Molecular Formula | C8H19NO4 |
| Molecular Weight | 193.24 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | 2-[2,2-dimethoxyethyl(2-hydroxyethyl)amino]ethanol |
| SMILES | COC(CN(CCO)CCO)OC |
| InChI | InChI=1S/C8H19NO4/c1-12-8(13-2)7-9(3-5-10)4-6-11/h8,10-11H,3-7H2,1-2H3 |
| InChIKey | DEUPNPAHRHCBGY-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.24 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-[2,2-dimethoxyethyl(2-hydroxyethyl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,2-dimethoxyethyl(2-hydroxyethyl)amino]ethanol?
The IUPAC name of 2-[2,2-dimethoxyethyl(2-hydroxyethyl)amino]ethanol (CID 66222761) is 2-[2,2-dimethoxyethyl(2-hydroxyethyl)amino]ethanol.
What is the SMILES notation for 2-[2,2-dimethoxyethyl(2-hydroxyethyl)amino]ethanol?
The canonical SMILES for 2-[2,2-dimethoxyethyl(2-hydroxyethyl)amino]ethanol is COC(CN(CCO)CCO)OC.
What is the InChIKey of 2-[2,2-dimethoxyethyl(2-hydroxyethyl)amino]ethanol?
The InChIKey is DEUPNPAHRHCBGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19NO4/c1-12-8(13-2)7-9(3-5-10)4-6-11/h8,10-11H,3-7H2,1-2H3.
What are the key properties of 2-[2,2-dimethoxyethyl(2-hydroxyethyl)amino]ethanol?
2-[2,2-dimethoxyethyl(2-hydroxyethyl)amino]ethanol has a molecular weight of 193.24 g/mol, XLogP of -1.11, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,2-dimethoxyethyl(2-hydroxyethyl)amino]ethanol is sourced from PubChem (CID 66222761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).