C17H21N3O3 — CID 6622311
1-methyl-4-[2-(4-methylpiperazin-1-yl)-2-oxoethoxy]quinolin-2-one (PubChem CID 6622311) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is 1-methyl-4-[2-(4-methylpiperazin-1-yl)-2-oxoethoxy]quinolin-2-one.
| Compound Name | 1-methyl-4-[2-(4-methylpiperazin-1-yl)-2-oxoethoxy]quinolin-2-one |
|---|---|
| PubChem CID | 6622311 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 1-methyl-4-[2-(4-methylpiperazin-1-yl)-2-oxoethoxy]quinolin-2-one |
| SMILES | CN1CCN(C(=O)COc2cc(=O)n(C)c3ccccc23)CC1 |
| InChI | InChI=1S/C17H21N3O3/c1-18-7-9-20(10-8-18)17(22)12-23-15-11-16(21)19(2)14-6-4-3-5-13(14)15/h3-6,11H,7-10,12H2,1-2H3 |
| InChIKey | XWSCGYOWQISXRS-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |