About 1-(2,2-dimethoxyethyl)-N,N-diethylpyrrolidin-3-amine
1-(2,2-dimethoxyethyl)-N,N-diethylpyrrolidin-3-amine (PubChem CID 66223207) has the molecular formula C12H26N2O2
and a molecular weight of 230.35 g/mol. Its IUPAC name is 1-(2,2-dimethoxyethyl)-N,N-diethylpyrrolidin-3-amine.
Molecular Properties
| Compound Name | 1-(2,2-dimethoxyethyl)-N,N-diethylpyrrolidin-3-amine |
| PubChem CID | 66223207 |
| Molecular Formula | C12H26N2O2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | 1-(2,2-dimethoxyethyl)-N,N-diethylpyrrolidin-3-amine |
| SMILES | CCN(CC)C1CCN(CC(OC)OC)C1 |
| InChI | InChI=1S/C12H26N2O2/c1-5-14(6-2)11-7-8-13(9-11)10-12(15-3)16-4/h11-12H,5-10H2,1-4H3 |
| InChIKey | OUXZEEAPLCHNCU-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,2-dimethoxyethyl)-N,N-diethylpyrrolidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-dimethoxyethyl)-N,N-diethylpyrrolidin-3-amine?
The IUPAC name of 1-(2,2-dimethoxyethyl)-N,N-diethylpyrrolidin-3-amine (CID 66223207) is 1-(2,2-dimethoxyethyl)-N,N-diethylpyrrolidin-3-amine.
What is the SMILES notation for 1-(2,2-dimethoxyethyl)-N,N-diethylpyrrolidin-3-amine?
The canonical SMILES for 1-(2,2-dimethoxyethyl)-N,N-diethylpyrrolidin-3-amine is CCN(CC)C1CCN(CC(OC)OC)C1.
What is the InChIKey of 1-(2,2-dimethoxyethyl)-N,N-diethylpyrrolidin-3-amine?
The InChIKey is OUXZEEAPLCHNCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N2O2/c1-5-14(6-2)11-7-8-13(9-11)10-12(15-3)16-4/h11-12H,5-10H2,1-4H3.
What are the key properties of 1-(2,2-dimethoxyethyl)-N,N-diethylpyrrolidin-3-amine?
1-(2,2-dimethoxyethyl)-N,N-diethylpyrrolidin-3-amine has a molecular weight of 230.35 g/mol, XLogP of 1.02, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-dimethoxyethyl)-N,N-diethylpyrrolidin-3-amine is sourced from PubChem (CID 66223207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).