About 1-(2,2-dimethoxyethyl)-5-nitropyrimidine-2,4-dione
1-(2,2-dimethoxyethyl)-5-nitropyrimidine-2,4-dione (PubChem CID 66223217) has the molecular formula C8H11N3O6
and a molecular weight of 245.19 g/mol. Its IUPAC name is 1-(2,2-dimethoxyethyl)-5-nitropyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 1-(2,2-dimethoxyethyl)-5-nitropyrimidine-2,4-dione |
| PubChem CID | 66223217 |
| Molecular Formula | C8H11N3O6 |
| Molecular Weight | 245.19 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 1-(2,2-dimethoxyethyl)-5-nitropyrimidine-2,4-dione |
| SMILES | COC(Cn1cc([N+](=O)[O-])c(=O)[nH]c1=O)OC |
| InChI | InChI=1S/C8H11N3O6/c1-16-6(17-2)4-10-3-5(11(14)15)7(12)9-8(10)13/h3,6H,4H2,1-2H3,(H,9,12,13) |
| InChIKey | BCBVYLQKBGHZOO-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 116.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.19 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,2-dimethoxyethyl)-5-nitropyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-dimethoxyethyl)-5-nitropyrimidine-2,4-dione?
The IUPAC name of 1-(2,2-dimethoxyethyl)-5-nitropyrimidine-2,4-dione (CID 66223217) is 1-(2,2-dimethoxyethyl)-5-nitropyrimidine-2,4-dione.
What is the SMILES notation for 1-(2,2-dimethoxyethyl)-5-nitropyrimidine-2,4-dione?
The canonical SMILES for 1-(2,2-dimethoxyethyl)-5-nitropyrimidine-2,4-dione is COC(Cn1cc([N+](=O)[O-])c(=O)[nH]c1=O)OC.
What is the InChIKey of 1-(2,2-dimethoxyethyl)-5-nitropyrimidine-2,4-dione?
The InChIKey is BCBVYLQKBGHZOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O6/c1-16-6(17-2)4-10-3-5(11(14)15)7(12)9-8(10)13/h3,6H,4H2,1-2H3,(H,9,12,13).
What are the key properties of 1-(2,2-dimethoxyethyl)-5-nitropyrimidine-2,4-dione?
1-(2,2-dimethoxyethyl)-5-nitropyrimidine-2,4-dione has a molecular weight of 245.19 g/mol, XLogP of -0.94, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-dimethoxyethyl)-5-nitropyrimidine-2,4-dione is sourced from PubChem (CID 66223217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).