About 2-(2,2-dimethoxyethylsulfanyl)-N,N-diethylethanamine
2-(2,2-dimethoxyethylsulfanyl)-N,N-diethylethanamine (PubChem CID 66223439) has the molecular formula C10H23NO2S
and a molecular weight of 221.37 g/mol. Its IUPAC name is 2-(2,2-dimethoxyethylsulfanyl)-N,N-diethylethanamine.
Molecular Properties
| Compound Name | 2-(2,2-dimethoxyethylsulfanyl)-N,N-diethylethanamine |
| PubChem CID | 66223439 |
| Molecular Formula | C10H23NO2S |
| Molecular Weight | 221.37 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 2-(2,2-dimethoxyethylsulfanyl)-N,N-diethylethanamine |
| SMILES | CCN(CC)CCSCC(OC)OC |
| InChI | InChI=1S/C10H23NO2S/c1-5-11(6-2)7-8-14-9-10(12-3)13-4/h10H,5-9H2,1-4H3 |
| InChIKey | SJXKUZRDJHTXFF-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.37 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,2-dimethoxyethylsulfanyl)-N,N-diethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-dimethoxyethylsulfanyl)-N,N-diethylethanamine?
The IUPAC name of 2-(2,2-dimethoxyethylsulfanyl)-N,N-diethylethanamine (CID 66223439) is 2-(2,2-dimethoxyethylsulfanyl)-N,N-diethylethanamine.
What is the SMILES notation for 2-(2,2-dimethoxyethylsulfanyl)-N,N-diethylethanamine?
The canonical SMILES for 2-(2,2-dimethoxyethylsulfanyl)-N,N-diethylethanamine is CCN(CC)CCSCC(OC)OC.
What is the InChIKey of 2-(2,2-dimethoxyethylsulfanyl)-N,N-diethylethanamine?
The InChIKey is SJXKUZRDJHTXFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23NO2S/c1-5-11(6-2)7-8-14-9-10(12-3)13-4/h10H,5-9H2,1-4H3.
What are the key properties of 2-(2,2-dimethoxyethylsulfanyl)-N,N-diethylethanamine?
2-(2,2-dimethoxyethylsulfanyl)-N,N-diethylethanamine has a molecular weight of 221.37 g/mol, XLogP of 1.68, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-dimethoxyethylsulfanyl)-N,N-diethylethanamine is sourced from PubChem (CID 66223439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).