C10H14Cl2N2S — CID 66223577
1-[(3,6-dichloro-2-pyridinyl)methylsulfanyl]-2-methylpropan-2-amine (PubChem CID 66223577) has the molecular formula C10H14Cl2N2S and a molecular weight of 265.21 g/mol. Its IUPAC name is 1-[(3,6-dichloro-2-pyridinyl)methylsulfanyl]-2-methylpropan-2-amine.
| Compound Name | 1-[(3,6-dichloro-2-pyridinyl)methylsulfanyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 66223577 |
| Molecular Formula | C10H14Cl2N2S |
| Molecular Weight | 265.21 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | 1-[(3,6-dichloro-2-pyridinyl)methylsulfanyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(N)CSCc1nc(Cl)ccc1Cl |
| InChI | InChI=1S/C10H14Cl2N2S/c1-10(2,13)6-15-5-8-7(11)3-4-9(12)14-8/h3-4H,5-6,13H2,1-2H3 |
| InChIKey | FWQOTAQGHLNVBF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.21 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|