C18H21N3O4 — CID 6622402
N-(2,2-dimethoxyethyl)-1,5-dimethyl-4-oxopyrrolo[3,2-c]quinoline-2-carboxamide (PubChem CID 6622402) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-1,5-dimethyl-4-oxopyrrolo[3,2-c]quinoline-2-carboxamide.
| Compound Name | N-(2,2-dimethoxyethyl)-1,5-dimethyl-4-oxopyrrolo[3,2-c]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 6622402 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-1,5-dimethyl-4-oxopyrrolo[3,2-c]quinoline-2-carboxamide |
| SMILES | COC(CNC(=O)c1cc2c(=O)n(C)c3ccccc3c2n1C)OC |
| InChI | InChI=1S/C18H21N3O4/c1-20-14(17(22)19-10-15(24-3)25-4)9-12-16(20)11-7-5-6-8-13(11)21(2)18(12)23/h5-9,15H,10H2,1-4H3,(H,19,22) |
| InChIKey | MJRKKLGLEPJORZ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|