About N'-(2,2-dimethoxyethyl)-N,N'-dimethylethane-1,2-diamine
N'-(2,2-dimethoxyethyl)-N,N'-dimethylethane-1,2-diamine (PubChem CID 66224074) has the molecular formula C8H20N2O2
and a molecular weight of 176.26 g/mol. Its IUPAC name is N'-(2,2-dimethoxyethyl)-N,N'-dimethylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(2,2-dimethoxyethyl)-N,N'-dimethylethane-1,2-diamine |
| PubChem CID | 66224074 |
| Molecular Formula | C8H20N2O2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.15 |
| IUPAC Name | N'-(2,2-dimethoxyethyl)-N,N'-dimethylethane-1,2-diamine |
| SMILES | CNCCN(C)CC(OC)OC |
| InChI | InChI=1S/C8H20N2O2/c1-9-5-6-10(2)7-8(11-3)12-4/h8-9H,5-7H2,1-4H3 |
| InChIKey | JWLDAAMTXAHVNP-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N'-(2,2-dimethoxyethyl)-N,N'-dimethylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2,2-dimethoxyethyl)-N,N'-dimethylethane-1,2-diamine?
The IUPAC name of N'-(2,2-dimethoxyethyl)-N,N'-dimethylethane-1,2-diamine (CID 66224074) is N'-(2,2-dimethoxyethyl)-N,N'-dimethylethane-1,2-diamine.
What is the SMILES notation for N'-(2,2-dimethoxyethyl)-N,N'-dimethylethane-1,2-diamine?
The canonical SMILES for N'-(2,2-dimethoxyethyl)-N,N'-dimethylethane-1,2-diamine is CNCCN(C)CC(OC)OC.
What is the InChIKey of N'-(2,2-dimethoxyethyl)-N,N'-dimethylethane-1,2-diamine?
The InChIKey is JWLDAAMTXAHVNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H20N2O2/c1-9-5-6-10(2)7-8(11-3)12-4/h8-9H,5-7H2,1-4H3.
What are the key properties of N'-(2,2-dimethoxyethyl)-N,N'-dimethylethane-1,2-diamine?
N'-(2,2-dimethoxyethyl)-N,N'-dimethylethane-1,2-diamine has a molecular weight of 176.26 g/mol, XLogP of -0.24, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2,2-dimethoxyethyl)-N,N'-dimethylethane-1,2-diamine is sourced from PubChem (CID 66224074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).