About 2-(2,2-dimethoxyethylsulfanyl)-1,3,4-thiadiazole
2-(2,2-dimethoxyethylsulfanyl)-1,3,4-thiadiazole (PubChem CID 66224085) has the molecular formula C6H10N2O2S2
and a molecular weight of 206.29 g/mol. Its IUPAC name is 2-(2,2-dimethoxyethylsulfanyl)-1,3,4-thiadiazole.
Molecular Properties
| Compound Name | 2-(2,2-dimethoxyethylsulfanyl)-1,3,4-thiadiazole |
| PubChem CID | 66224085 |
| Molecular Formula | C6H10N2O2S2 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.02 |
| IUPAC Name | 2-(2,2-dimethoxyethylsulfanyl)-1,3,4-thiadiazole |
| SMILES | COC(CSc1nncs1)OC |
| InChI | InChI=1S/C6H10N2O2S2/c1-9-5(10-2)3-11-6-8-7-4-12-6/h4-5H,3H2,1-2H3 |
| InChIKey | DXPXPVOJMHZHGD-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,2-dimethoxyethylsulfanyl)-1,3,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-dimethoxyethylsulfanyl)-1,3,4-thiadiazole?
The IUPAC name of 2-(2,2-dimethoxyethylsulfanyl)-1,3,4-thiadiazole (CID 66224085) is 2-(2,2-dimethoxyethylsulfanyl)-1,3,4-thiadiazole.
What is the SMILES notation for 2-(2,2-dimethoxyethylsulfanyl)-1,3,4-thiadiazole?
The canonical SMILES for 2-(2,2-dimethoxyethylsulfanyl)-1,3,4-thiadiazole is COC(CSc1nncs1)OC.
What is the InChIKey of 2-(2,2-dimethoxyethylsulfanyl)-1,3,4-thiadiazole?
The InChIKey is DXPXPVOJMHZHGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O2S2/c1-9-5(10-2)3-11-6-8-7-4-12-6/h4-5H,3H2,1-2H3.
What are the key properties of 2-(2,2-dimethoxyethylsulfanyl)-1,3,4-thiadiazole?
2-(2,2-dimethoxyethylsulfanyl)-1,3,4-thiadiazole has a molecular weight of 206.29 g/mol, XLogP of 1.25, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-dimethoxyethylsulfanyl)-1,3,4-thiadiazole is sourced from PubChem (CID 66224085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).