About (5-iodo-1,3-thiazol-2-yl)methanol
(5-iodo-1,3-thiazol-2-yl)methanol (PubChem CID 66224116) has the molecular formula C4H4INOS
and a molecular weight of 241.05 g/mol. Its IUPAC name is (5-iodo-1,3-thiazol-2-yl)methanol.
Molecular Properties
| Compound Name | (5-iodo-1,3-thiazol-2-yl)methanol |
| PubChem CID | 66224116 |
| Molecular Formula | C4H4INOS |
| Molecular Weight | 241.05 g/mol |
| Exact Mass | 240.91 |
| IUPAC Name | (5-iodo-1,3-thiazol-2-yl)methanol |
| SMILES | OCc1ncc(I)s1 |
| InChI | InChI=1S/C4H4INOS/c5-3-1-6-4(2-7)8-3/h1,7H,2H2 |
| InChIKey | QHNGRUPHOMCMPN-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.05 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (5-iodo-1,3-thiazol-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-iodo-1,3-thiazol-2-yl)methanol?
The IUPAC name of (5-iodo-1,3-thiazol-2-yl)methanol (CID 66224116) is (5-iodo-1,3-thiazol-2-yl)methanol.
What is the SMILES notation for (5-iodo-1,3-thiazol-2-yl)methanol?
The canonical SMILES for (5-iodo-1,3-thiazol-2-yl)methanol is OCc1ncc(I)s1.
What is the InChIKey of (5-iodo-1,3-thiazol-2-yl)methanol?
The InChIKey is QHNGRUPHOMCMPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4INOS/c5-3-1-6-4(2-7)8-3/h1,7H,2H2.
What are the key properties of (5-iodo-1,3-thiazol-2-yl)methanol?
(5-iodo-1,3-thiazol-2-yl)methanol has a molecular weight of 241.05 g/mol, XLogP of 1.24, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-iodo-1,3-thiazol-2-yl)methanol is sourced from PubChem (CID 66224116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).