C11H18F3NO2S — CID 66224834
3-methyl-8-(trifluoromethyl)-2,3,4,5,5a,6,7,8,9,9a-decahydrobenzo[b][1,4]thiazepine 1,1-dioxide (PubChem CID 66224834) has the molecular formula C11H18F3NO2S and a molecular weight of 285.33 g/mol. Its IUPAC name is 3-methyl-8-(trifluoromethyl)-2,3,4,5,5a,6,7,8,9,9a-decahydrobenzo[b][1,4]thiazepine 1,1-dioxide.
| Compound Name | 3-methyl-8-(trifluoromethyl)-2,3,4,5,5a,6,7,8,9,9a-decahydrobenzo[b][1,4]thiazepine 1,1-dioxide |
|---|---|
| PubChem CID | 66224834 |
| Molecular Formula | C11H18F3NO2S |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 3-methyl-8-(trifluoromethyl)-2,3,4,5,5a,6,7,8,9,9a-decahydrobenzo[b][1,4]thiazepine 1,1-dioxide |
| SMILES | CC1CNC2CCC(C(F)(F)F)CC2S(=O)(=O)C1 |
| InChI | InChI=1S/C11H18F3NO2S/c1-7-5-15-9-3-2-8(11(12,13)14)4-10(9)18(16,17)6-7/h7-10,15H,2-6H2,1H3 |
| InChIKey | UBQAIOBNSPJCNU-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |