About 2-benzyl-6-methyl-1,3-thiazinane
2-benzyl-6-methyl-1,3-thiazinane (PubChem CID 66224897) has the molecular formula C12H17NS
and a molecular weight of 207.34 g/mol. Its IUPAC name is 2-benzyl-6-methyl-1,3-thiazinane.
Molecular Properties
| Compound Name | 2-benzyl-6-methyl-1,3-thiazinane |
| PubChem CID | 66224897 |
| Molecular Formula | C12H17NS |
| Molecular Weight | 207.34 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 2-benzyl-6-methyl-1,3-thiazinane |
| SMILES | CC1CCNC(Cc2ccccc2)S1 |
| InChI | InChI=1S/C12H17NS/c1-10-7-8-13-12(14-10)9-11-5-3-2-4-6-11/h2-6,10,12-13H,7-9H2,1H3 |
| InChIKey | ZYTMSORADAQXGS-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.34 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-benzyl-6-methyl-1,3-thiazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-6-methyl-1,3-thiazinane?
The IUPAC name of 2-benzyl-6-methyl-1,3-thiazinane (CID 66224897) is 2-benzyl-6-methyl-1,3-thiazinane.
What is the SMILES notation for 2-benzyl-6-methyl-1,3-thiazinane?
The canonical SMILES for 2-benzyl-6-methyl-1,3-thiazinane is CC1CCNC(Cc2ccccc2)S1.
What is the InChIKey of 2-benzyl-6-methyl-1,3-thiazinane?
The InChIKey is ZYTMSORADAQXGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NS/c1-10-7-8-13-12(14-10)9-11-5-3-2-4-6-11/h2-6,10,12-13H,7-9H2,1H3.
What are the key properties of 2-benzyl-6-methyl-1,3-thiazinane?
2-benzyl-6-methyl-1,3-thiazinane has a molecular weight of 207.34 g/mol, XLogP of 2.67, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-6-methyl-1,3-thiazinane is sourced from PubChem (CID 66224897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).